C12H16N4 — CID 139350886
3-[(2S)-1-(4-methyl-1,2,4-triazol-3-yl)propan-2-yl]aniline (PubChem CID 139350886) has the molecular formula C12H16N4 and a molecular weight of 216.29 g/mol. Its IUPAC name is 3-[(2S)-1-(4-methyl-1,2,4-triazol-3-yl)propan-2-yl]aniline.
| Compound Name | 3-[(2S)-1-(4-methyl-1,2,4-triazol-3-yl)propan-2-yl]aniline |
|---|---|
| PubChem CID | 139350886 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 3-[(2S)-1-(4-methyl-1,2,4-triazol-3-yl)propan-2-yl]aniline |
| SMILES | C[C@@H](Cc1nncn1C)c1cccc(N)c1 |
| InChI | InChI=1S/C12H16N4/c1-9(6-12-15-14-8-16(12)2)10-4-3-5-11(13)7-10/h3-5,7-9H,6,13H2,1-2H3/t9-/m0/s1 |
| InChIKey | RKIGMJZTBBSXRW-VIFPVBQESA-N |
| XLogP | 1.74 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|