About aniline;3-(2-ethylbutyl)-4-methyl-1,2,4-triazole
aniline;3-(2-ethylbutyl)-4-methyl-1,2,4-triazole (PubChem CID 178119125) has the molecular formula C15H24N4
and a molecular weight of 260.38 g/mol. Its IUPAC name is aniline;3-(2-ethylbutyl)-4-methyl-1,2,4-triazole.
Molecular Properties
| Compound Name | aniline;3-(2-ethylbutyl)-4-methyl-1,2,4-triazole |
| PubChem CID | 178119125 |
| Molecular Formula | C15H24N4 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | aniline;3-(2-ethylbutyl)-4-methyl-1,2,4-triazole |
| SMILES | CCC(CC)Cc1nncn1C.Nc1ccccc1 |
| InChI | InChI=1S/C9H17N3.C6H7N/c1-4-8(5-2)6-9-11-10-7-12(9)3;7-6-4-2-1-3-5-6/h7-8H,4-6H2,1-3H3;1-5H,7H2 |
| InChIKey | KMUGFDFQKXTDOU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze aniline;3-(2-ethylbutyl)-4-methyl-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aniline;3-(2-ethylbutyl)-4-methyl-1,2,4-triazole?
The IUPAC name of aniline;3-(2-ethylbutyl)-4-methyl-1,2,4-triazole (CID 178119125) is aniline;3-(2-ethylbutyl)-4-methyl-1,2,4-triazole.
What is the SMILES notation for aniline;3-(2-ethylbutyl)-4-methyl-1,2,4-triazole?
The canonical SMILES for aniline;3-(2-ethylbutyl)-4-methyl-1,2,4-triazole is CCC(CC)Cc1nncn1C.Nc1ccccc1.
What is the InChIKey of aniline;3-(2-ethylbutyl)-4-methyl-1,2,4-triazole?
The InChIKey is KMUGFDFQKXTDOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3.C6H7N/c1-4-8(5-2)6-9-11-10-7-12(9)3;7-6-4-2-1-3-5-6/h7-8H,4-6H2,1-3H3;1-5H,7H2.
What are the key properties of aniline;3-(2-ethylbutyl)-4-methyl-1,2,4-triazole?
aniline;3-(2-ethylbutyl)-4-methyl-1,2,4-triazole has a molecular weight of 260.38 g/mol, XLogP of 3.06, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for aniline;3-(2-ethylbutyl)-4-methyl-1,2,4-triazole is sourced from PubChem (CID 178119125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).