C11H14N6O — CID 62117941
1-(3-aminophenyl)-3-[(4-methyl-1,2,4-triazol-3-yl)methyl]urea (PubChem CID 62117941) has the molecular formula C11H14N6O and a molecular weight of 246.27 g/mol. Its IUPAC name is 1-(3-aminophenyl)-3-[(4-methyl-1,2,4-triazol-3-yl)methyl]urea.
| Compound Name | 1-(3-aminophenyl)-3-[(4-methyl-1,2,4-triazol-3-yl)methyl]urea |
|---|---|
| PubChem CID | 62117941 |
| Molecular Formula | C11H14N6O |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 1-(3-aminophenyl)-3-[(4-methyl-1,2,4-triazol-3-yl)methyl]urea |
| SMILES | Cn1cnnc1CNC(=O)Nc1cccc(N)c1 |
| InChI | InChI=1S/C11H14N6O/c1-17-7-14-16-10(17)6-13-11(18)15-9-4-2-3-8(12)5-9/h2-5,7H,6,12H2,1H3,(H2,13,15,18) |
| InChIKey | KROZVOFLXBJOEB-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 97.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|