C13H15N5O3 — CID 63330396
3-[2-(4-methyl-1,2,4-triazol-3-yl)ethylcarbamoylamino]benzoic acid (PubChem CID 63330396) has the molecular formula C13H15N5O3 and a molecular weight of 289.30 g/mol. Its IUPAC name is 3-[2-(4-methyl-1,2,4-triazol-3-yl)ethylcarbamoylamino]benzoic acid.
| Compound Name | 3-[2-(4-methyl-1,2,4-triazol-3-yl)ethylcarbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 63330396 |
| Molecular Formula | C13H15N5O3 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 3-[2-(4-methyl-1,2,4-triazol-3-yl)ethylcarbamoylamino]benzoic acid |
| SMILES | Cn1cnnc1CCNC(=O)Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C13H15N5O3/c1-18-8-15-17-11(18)5-6-14-13(21)16-10-4-2-3-9(7-10)12(19)20/h2-4,7-8H,5-6H2,1H3,(H,19,20)(H2,14,16,21) |
| InChIKey | QGJZQEQETCZWLE-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |