C14H26N2O2 — CID 166559286
(2R)-2-amino-2-(cyclohexanecarbonyl)-4,4-dimethylpentanamide (PubChem CID 166559286) has the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. Its IUPAC name is (2R)-2-amino-2-(cyclohexanecarbonyl)-4,4-dimethylpentanamide.
| Compound Name | (2R)-2-amino-2-(cyclohexanecarbonyl)-4,4-dimethylpentanamide |
|---|---|
| PubChem CID | 166559286 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | (2R)-2-amino-2-(cyclohexanecarbonyl)-4,4-dimethylpentanamide |
| SMILES | CC(C)(C)C[C@](N)(C(N)=O)C(=O)C1CCCCC1 |
| InChI | InChI=1S/C14H26N2O2/c1-13(2,3)9-14(16,12(15)18)11(17)10-7-5-4-6-8-10/h10H,4-9,16H2,1-3H3,(H2,15,18)/t14-/m1/s1 |
| InChIKey | RVMBKACROUAHPQ-CQSZACIVSA-N |
| XLogP | 1.75 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|