C10H17ClF2 — CID 166561589
5-tert-butyl-2-chloro-1,3-difluorocyclohexane (PubChem CID 166561589) has the molecular formula C10H17ClF2 and a molecular weight of 210.70 g/mol. Its IUPAC name is 5-tert-butyl-2-chloro-1,3-difluorocyclohexane.
| Compound Name | 5-tert-butyl-2-chloro-1,3-difluorocyclohexane |
|---|---|
| PubChem CID | 166561589 |
| Molecular Formula | C10H17ClF2 |
| Molecular Weight | 210.70 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 5-tert-butyl-2-chloro-1,3-difluorocyclohexane |
| SMILES | CC(C)(C)C1CC(F)C(Cl)C(F)C1 |
| InChI | InChI=1S/C10H17ClF2/c1-10(2,3)6-4-7(12)9(11)8(13)5-6/h6-9H,4-5H2,1-3H3 |
| InChIKey | ITLXNYMMLOUNED-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.70 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|