C13H22ClF — CID 89380518
2-chloro-4-(1,2-diethylcyclopropyl)-1-fluorocyclohexane (PubChem CID 89380518) has the molecular formula C13H22ClF and a molecular weight of 232.77 g/mol. Its IUPAC name is 2-chloro-4-(1,2-diethylcyclopropyl)-1-fluorocyclohexane.
| Compound Name | 2-chloro-4-(1,2-diethylcyclopropyl)-1-fluorocyclohexane |
|---|---|
| PubChem CID | 89380518 |
| Molecular Formula | C13H22ClF |
| Molecular Weight | 232.77 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | 2-chloro-4-(1,2-diethylcyclopropyl)-1-fluorocyclohexane |
| SMILES | CCC1CC1(CC)C1CCC(F)C(Cl)C1 |
| InChI | InChI=1S/C13H22ClF/c1-3-9-8-13(9,4-2)10-5-6-12(15)11(14)7-10/h9-12H,3-8H2,1-2H3 |
| InChIKey | XXGBZSXFNOZKTN-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.77 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|