C41H38BNSSi2 — CID 166563249
10,10,14,14,20,20-hexamethyl-N,N-diphenyl-12-thia-14,20-disila-1-boraheptacyclo[13.11.1.02,13.03,11.04,9.019,27.021,26]heptacosa-2(13),3(11),4,6,8,15,17,19(27),21(26),22,24-undecaen-23-amine (PubChem CID 166563249) has the molecular formula C41H38BNSSi2 and a molecular weight of 643.81 g/mol. Its IUPAC name is 10,10,14,14,20,20-hexamethyl-N,N-diphenyl-12-thia-14,20-disila-1-boraheptacyclo[13.11.1.02,13.03,11.04,9.019,27.021,26]heptacosa-2(13),3(11),4,6,8,15,17,19(27),21(26),22,24-undecaen-23-amine.
| Compound Name | 10,10,14,14,20,20-hexamethyl-N,N-diphenyl-12-thia-14,20-disila-1-boraheptacyclo[13.11.1.02,13.03,11.04,9.019,27.021,26]heptacosa-2(13),3(11),4,6,8,15,17,19(27),21(26),22,24-undecaen-23-amine |
|---|---|
| PubChem CID | 166563249 |
| Molecular Formula | C41H38BNSSi2 |
| Molecular Weight | 643.81 g/mol |
| Exact Mass | 643.24 |
| IUPAC Name | 10,10,14,14,20,20-hexamethyl-N,N-diphenyl-12-thia-14,20-disila-1-boraheptacyclo[13.11.1.02,13.03,11.04,9.019,27.021,26]heptacosa-2(13),3(11),4,6,8,15,17,19(27),21(26),22,24-undecaen-23-amine |
| SMILES | CC1(C)c2ccccc2-c2c1sc1c2B2c3ccc(N(c4ccccc4)c4ccccc4)cc3[Si](C)(C)c3cccc(c32)[Si]1(C)C |
| InChI | InChI=1S/C41H38BNSSi2/c1-41(2)31-21-14-13-20-30(31)36-38-40(44-39(36)41)46(5,6)34-23-15-22-33-37(34)42(38)32-25-24-29(26-35(32)45(33,3)4)43(27-16-9-7-10-17-27)28-18-11-8-12-19-28/h7-26H,1-6H3 |
| InChIKey | JYSKDFMEYYUTBL-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.81 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|