C37H43N — CID 166564278
4-tert-butyl-5-[(3,5-ditert-butylphenyl)methyl]-9-phenylcarbazole (PubChem CID 166564278) has the molecular formula C37H43N and a molecular weight of 501.76 g/mol. Its IUPAC name is 4-tert-butyl-5-[(3,5-ditert-butylphenyl)methyl]-9-phenylcarbazole.
| Compound Name | 4-tert-butyl-5-[(3,5-ditert-butylphenyl)methyl]-9-phenylcarbazole |
|---|---|
| PubChem CID | 166564278 |
| Molecular Formula | C37H43N |
| Molecular Weight | 501.76 g/mol |
| Exact Mass | 501.34 |
| IUPAC Name | 4-tert-butyl-5-[(3,5-ditert-butylphenyl)methyl]-9-phenylcarbazole |
| SMILES | CC(C)(C)c1cc(Cc2cccc3c2c2c(C(C)(C)C)cccc2n3-c2ccccc2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C37H43N/c1-35(2,3)27-22-25(23-28(24-27)36(4,5)6)21-26-15-13-19-31-33(26)34-30(37(7,8)9)18-14-20-32(34)38(31)29-16-11-10-12-17-29/h10-20,22-24H,21H2,1-9H3 |
| InChIKey | GEFRQXWDHGMXQS-UHFFFAOYSA-N |
| XLogP | 10.27 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.76 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |