C48H65N — CID 146579007
3,4-ditert-butyl-5,9-bis(3,5-ditert-butylphenyl)carbazole (PubChem CID 146579007) has the molecular formula C48H65N and a molecular weight of 656.05 g/mol. Its IUPAC name is 3,4-ditert-butyl-5,9-bis(3,5-ditert-butylphenyl)carbazole.
| Compound Name | 3,4-ditert-butyl-5,9-bis(3,5-ditert-butylphenyl)carbazole |
|---|---|
| PubChem CID | 146579007 |
| Molecular Formula | C48H65N |
| Molecular Weight | 656.05 g/mol |
| Exact Mass | 655.51 |
| IUPAC Name | 3,4-ditert-butyl-5,9-bis(3,5-ditert-butylphenyl)carbazole |
| SMILES | CC(C)(C)c1cc(-c2cccc3c2c2c(C(C)(C)C)c(C(C)(C)C)ccc2n3-c2cc(C(C)(C)C)cc(C(C)(C)C)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C48H65N/c1-43(2,3)31-24-30(25-32(26-31)44(4,5)6)36-20-19-21-38-40(36)41-39(23-22-37(47(13,14)15)42(41)48(16,17)18)49(38)35-28-33(45(7,8)9)27-34(29-35)46(10,11)12/h19-29H,1-18H3 |
| InChIKey | NEIIYXPNQUDEFS-UHFFFAOYSA-N |
| XLogP | 14.24 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.05 |
| LogP ≤ 5 | 14.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |