C45H59N — CID 164845430
3-tert-butyl-5,9-bis(3,5-ditert-butylphenyl)-4-methylcarbazole (PubChem CID 164845430) has the molecular formula C45H59N and a molecular weight of 613.97 g/mol. Its IUPAC name is 3-tert-butyl-5,9-bis(3,5-ditert-butylphenyl)-4-methylcarbazole.
| Compound Name | 3-tert-butyl-5,9-bis(3,5-ditert-butylphenyl)-4-methylcarbazole |
|---|---|
| PubChem CID | 164845430 |
| Molecular Formula | C45H59N |
| Molecular Weight | 613.97 g/mol |
| Exact Mass | 613.46 |
| IUPAC Name | 3-tert-butyl-5,9-bis(3,5-ditert-butylphenyl)-4-methylcarbazole |
| SMILES | Cc1c(C(C)(C)C)ccc2c1c1c(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)cccc1n2-c1cc(C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C45H59N/c1-28-36(45(14,15)16)20-21-38-39(28)40-35(29-22-30(41(2,3)4)24-31(23-29)42(5,6)7)18-17-19-37(40)46(38)34-26-32(43(8,9)10)25-33(27-34)44(11,12)13/h17-27H,1-16H3 |
| InChIKey | XJKMOJQATJUKTI-UHFFFAOYSA-N |
| XLogP | 13.25 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.97 |
| LogP ≤ 5 | 13.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |