C49H57N — CID 146579609
12,20-bis(3,5-ditert-butylphenyl)-14,14-dimethyl-20-azapentacyclo[13.3.1.16,9.02,7.08,13]icosa-1(19),2(7),3,5,8,10,12,15,17-nonaene (PubChem CID 146579609) has the molecular formula C49H57N and a molecular weight of 660.00 g/mol. Its IUPAC name is 12,20-bis(3,5-ditert-butylphenyl)-14,14-dimethyl-20-azapentacyclo[13.3.1.16,9.02,7.08,13]icosa-1(19),2(7),3,5,8,10,12,15,17-nonaene.
| Compound Name | 12,20-bis(3,5-ditert-butylphenyl)-14,14-dimethyl-20-azapentacyclo[13.3.1.16,9.02,7.08,13]icosa-1(19),2(7),3,5,8,10,12,15,17-nonaene |
|---|---|
| PubChem CID | 146579609 |
| Molecular Formula | C49H57N |
| Molecular Weight | 660.00 g/mol |
| Exact Mass | 659.45 |
| IUPAC Name | 12,20-bis(3,5-ditert-butylphenyl)-14,14-dimethyl-20-azapentacyclo[13.3.1.16,9.02,7.08,13]icosa-1(19),2(7),3,5,8,10,12,15,17-nonaene |
| SMILES | CC(C)(C)c1cc(-c2ccc3c4c2C(C)(C)c2cccc(c2)-c2cccc(c24)n3-c2cc(C(C)(C)C)cc(C(C)(C)C)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C49H57N/c1-45(2,3)33-24-31(25-34(26-33)46(4,5)6)39-21-22-41-43-42-38(30-17-15-18-32(23-30)49(13,14)44(39)43)19-16-20-40(42)50(41)37-28-35(47(7,8)9)27-36(29-37)48(10,11)12/h15-29H,1-14H3 |
| InChIKey | IVUCKODTINBBJF-UHFFFAOYSA-N |
| XLogP | 13.95 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.00 |
| LogP ≤ 5 | 13.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |