C10H18FNO — CID 166567483
(8S)-2-tert-butyl-8-fluoro-5-oxa-2-azaspiro[3.4]octane (PubChem CID 166567483) has the molecular formula C10H18FNO and a molecular weight of 187.26 g/mol. Its IUPAC name is (8S)-2-tert-butyl-8-fluoro-5-oxa-2-azaspiro[3.4]octane.
| Compound Name | (8S)-2-tert-butyl-8-fluoro-5-oxa-2-azaspiro[3.4]octane |
|---|---|
| PubChem CID | 166567483 |
| Molecular Formula | C10H18FNO |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | (8S)-2-tert-butyl-8-fluoro-5-oxa-2-azaspiro[3.4]octane |
| SMILES | CC(C)(C)N1CC2(C1)OCC[C@@H]2F |
| InChI | InChI=1S/C10H18FNO/c1-9(2,3)12-6-10(7-12)8(11)4-5-13-10/h8H,4-7H2,1-3H3/t8-/m0/s1 |
| InChIKey | INFJVRWBJBQPRE-QMMMGPOBSA-N |
| XLogP | 1.60 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |