C9H7BrN6 — CID 166567908
5-(1-bromoethyl)-1-pyrimidin-2-yl-1,2,4-triazole-3-carbonitrile (PubChem CID 166567908) has the molecular formula C9H7BrN6 and a molecular weight of 279.10 g/mol. Its IUPAC name is 5-(1-bromoethyl)-1-pyrimidin-2-yl-1,2,4-triazole-3-carbonitrile.
| Compound Name | 5-(1-bromoethyl)-1-pyrimidin-2-yl-1,2,4-triazole-3-carbonitrile |
|---|---|
| PubChem CID | 166567908 |
| Molecular Formula | C9H7BrN6 |
| Molecular Weight | 279.10 g/mol |
| Exact Mass | 277.99 |
| IUPAC Name | 5-(1-bromoethyl)-1-pyrimidin-2-yl-1,2,4-triazole-3-carbonitrile |
| SMILES | CC(Br)c1nc(C#N)nn1-c1ncccn1 |
| InChI | InChI=1S/C9H7BrN6/c1-6(10)8-14-7(5-11)15-16(8)9-12-3-2-4-13-9/h2-4,6H,1H3 |
| InChIKey | NHSAPLYEKAGWMH-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 80.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.10 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|