About azane;2-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrimidine
azane;2-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrimidine (PubChem CID 175302032) has the molecular formula C8H12N6
and a molecular weight of 192.23 g/mol. Its IUPAC name is azane;2-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrimidine.
Molecular Properties
| Compound Name | azane;2-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrimidine |
| PubChem CID | 175302032 |
| Molecular Formula | C8H12N6 |
| Molecular Weight | 192.23 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | azane;2-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrimidine |
| SMILES | Cc1nc(C)n(-c2ncccn2)n1.N |
| InChI | InChI=1S/C8H9N5.H3N/c1-6-11-7(2)13(12-6)8-9-4-3-5-10-8;/h3-5H,1-2H3;1H3 |
| InChIKey | JRZSVJAWKPQKIH-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.23 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze azane;2-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrimidine?
The IUPAC name of azane;2-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrimidine (CID 175302032) is azane;2-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrimidine.
What is the SMILES notation for azane;2-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrimidine?
The canonical SMILES for azane;2-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrimidine is Cc1nc(C)n(-c2ncccn2)n1.N.
What is the InChIKey of azane;2-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrimidine?
The InChIKey is JRZSVJAWKPQKIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N5.H3N/c1-6-11-7(2)13(12-6)8-9-4-3-5-10-8;/h3-5H,1-2H3;1H3.
What are the key properties of azane;2-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrimidine?
azane;2-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrimidine has a molecular weight of 192.23 g/mol, XLogP of 0.84, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrimidine is sourced from PubChem (CID 175302032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).