C8H12N6 — CID 175302032
azane;2-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrimidine (PubChem CID 175302032) has the molecular formula C8H12N6 and a molecular weight of 192.23 g/mol. Its IUPAC name is azane;2-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrimidine.
| Compound Name | azane;2-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrimidine |
|---|---|
| PubChem CID | 175302032 |
| Molecular Formula | C8H12N6 |
| Molecular Weight | 192.23 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | azane;2-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrimidine |
| SMILES | Cc1nc(C)n(-c2ncccn2)n1.N |
| InChI | InChI=1S/C8H9N5.H3N/c1-6-11-7(2)13(12-6)8-9-4-3-5-10-8;/h3-5H,1-2H3;1H3 |
| InChIKey | JRZSVJAWKPQKIH-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.23 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |