C9H9N5O2 — CID 135041627
3-(3,5-dimethyl-1,2,4-triazol-1-yl)-2-nitropyridine (PubChem CID 135041627) has the molecular formula C9H9N5O2 and a molecular weight of 219.20 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1,2,4-triazol-1-yl)-2-nitropyridine.
| Compound Name | 3-(3,5-dimethyl-1,2,4-triazol-1-yl)-2-nitropyridine |
|---|---|
| PubChem CID | 135041627 |
| Molecular Formula | C9H9N5O2 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 3-(3,5-dimethyl-1,2,4-triazol-1-yl)-2-nitropyridine |
| SMILES | Cc1nc(C)n(-c2cccnc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C9H9N5O2/c1-6-11-7(2)13(12-6)8-4-3-5-10-9(8)14(15)16/h3-5H,1-2H3 |
| InChIKey | VANDESUMNQMKKW-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|