C51H35N3OSi — CID 166569886
[4-[4-dibenzofuran-1-yl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-triphenylsilane (PubChem CID 166569886) has the molecular formula C51H35N3OSi and a molecular weight of 733.95 g/mol. Its IUPAC name is [4-[4-dibenzofuran-1-yl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-triphenylsilane.
| Compound Name | [4-[4-dibenzofuran-1-yl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-triphenylsilane |
|---|---|
| PubChem CID | 166569886 |
| Molecular Formula | C51H35N3OSi |
| Molecular Weight | 733.95 g/mol |
| Exact Mass | 733.25 |
| IUPAC Name | [4-[4-dibenzofuran-1-yl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-triphenylsilane |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccc([Si](c5ccccc5)(c5ccccc5)c5ccccc5)cc4)nc(-c4cccc5oc6ccccc6c45)n3)cc2)cc1 |
| InChI | InChI=1S/C51H35N3OSi/c1-5-16-36(17-6-1)37-28-30-38(31-29-37)49-52-50(54-51(53-49)45-25-15-27-47-48(45)44-24-13-14-26-46(44)55-47)39-32-34-43(35-33-39)56(40-18-7-2-8-19-40,41-20-9-3-10-21-41)42-22-11-4-12-23-42/h1-35H |
| InChIKey | GRPBIEOCDWYTBL-UHFFFAOYSA-N |
| XLogP | 9.82 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.95 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|