C45H31N3OSi — CID 166569930
[4-[4-dibenzofuran-1-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]phenyl]-triphenylsilane (PubChem CID 166569930) has the molecular formula C45H31N3OSi and a molecular weight of 662.88 g/mol. Its IUPAC name is [4-[4-dibenzofuran-1-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]phenyl]-triphenylsilane.
| Compound Name | [4-[4-dibenzofuran-1-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]phenyl]-triphenylsilane |
|---|---|
| PubChem CID | 166569930 |
| Molecular Formula | C45H31N3OSi |
| Molecular Weight | 662.88 g/mol |
| Exact Mass | 662.26 |
| IUPAC Name | [4-[4-dibenzofuran-1-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]phenyl]-triphenylsilane |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3ccc([Si](c4ccccc4)(c4ccccc4)c4ccccc4)cc3)nc(-c3cccc4oc5ccccc5c34)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C45H31N3OSi/c1-5-16-32(17-6-1)43-46-44(48-45(47-43)39-25-15-27-41-42(39)38-24-13-14-26-40(38)49-41)33-28-30-37(31-29-33)50(34-18-7-2-8-19-34,35-20-9-3-10-21-35)36-22-11-4-12-23-36/h1-31H/i1D,5D,6D,16D,17D |
| InChIKey | JNBYPNSLYWEKJA-MUWLZSFYSA-N |
| XLogP | 8.15 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.88 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|