C14H22O6 — CID 166570891
4-acetylhept-6-enyl 2-(2-hydroxyacetyl)oxypropanoate (PubChem CID 166570891) has the molecular formula C14H22O6 and a molecular weight of 286.32 g/mol. Its IUPAC name is 4-acetylhept-6-enyl 2-(2-hydroxyacetyl)oxypropanoate.
| Compound Name | 4-acetylhept-6-enyl 2-(2-hydroxyacetyl)oxypropanoate |
|---|---|
| PubChem CID | 166570891 |
| Molecular Formula | C14H22O6 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 4-acetylhept-6-enyl 2-(2-hydroxyacetyl)oxypropanoate |
| SMILES | C=CCC(CCCOC(=O)C(C)OC(=O)CO)C(C)=O |
| InChI | InChI=1S/C14H22O6/c1-4-6-12(10(2)16)7-5-8-19-14(18)11(3)20-13(17)9-15/h4,11-12,15H,1,5-9H2,2-3H3 |
| InChIKey | VLSRWUNNNTYCHY-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|