C13H24O6 — CID 176777367
2-(3,3-dimethylbutoxy)ethyl 2-(2-hydroxyacetyl)oxypropanoate (PubChem CID 176777367) has the molecular formula C13H24O6 and a molecular weight of 276.33 g/mol. Its IUPAC name is 2-(3,3-dimethylbutoxy)ethyl 2-(2-hydroxyacetyl)oxypropanoate.
| Compound Name | 2-(3,3-dimethylbutoxy)ethyl 2-(2-hydroxyacetyl)oxypropanoate |
|---|---|
| PubChem CID | 176777367 |
| Molecular Formula | C13H24O6 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 2-(3,3-dimethylbutoxy)ethyl 2-(2-hydroxyacetyl)oxypropanoate |
| SMILES | CC(OC(=O)CO)C(=O)OCCOCCC(C)(C)C |
| InChI | InChI=1S/C13H24O6/c1-10(19-11(15)9-14)12(16)18-8-7-17-6-5-13(2,3)4/h10,14H,5-9H2,1-4H3 |
| InChIKey | PWQAOPBJWFGKEX-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|