C23H24ClN3O3 — CID 166572567
7-chloro-2-[(3,5-dimethoxyphenyl)methyl]-5-(1,4-dimethylimidazol-2-yl)-3,4-dihydroisoquinolin-1-one (PubChem CID 166572567) has the molecular formula C23H24ClN3O3 and a molecular weight of 425.92 g/mol. Its IUPAC name is 7-chloro-2-[(3,5-dimethoxyphenyl)methyl]-5-(1,4-dimethylimidazol-2-yl)-3,4-dihydroisoquinolin-1-one.
| Compound Name | 7-chloro-2-[(3,5-dimethoxyphenyl)methyl]-5-(1,4-dimethylimidazol-2-yl)-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 166572567 |
| Molecular Formula | C23H24ClN3O3 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 7-chloro-2-[(3,5-dimethoxyphenyl)methyl]-5-(1,4-dimethylimidazol-2-yl)-3,4-dihydroisoquinolin-1-one |
| SMILES | COc1cc(CN2CCc3c(cc(Cl)cc3-c3nc(C)cn3C)C2=O)cc(OC)c1 |
| InChI | InChI=1S/C23H24ClN3O3/c1-14-12-26(2)22(25-14)20-9-16(24)10-21-19(20)5-6-27(23(21)28)13-15-7-17(29-3)11-18(8-15)30-4/h7-12H,5-6,13H2,1-4H3 |
| InChIKey | LQVDVTDCUCZNMG-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|