About ethyl 4-methoxy-6-[(4-methoxyphenyl)methyl]-5-oxo-7,8-dihydro-2,6-naphthyridine-1-carboxylate
ethyl 4-methoxy-6-[(4-methoxyphenyl)methyl]-5-oxo-7,8-dihydro-2,6-naphthyridine-1-carboxylate (PubChem CID 67515740) has the molecular formula C20H22N2O5
and a molecular weight of 370.41 g/mol. Its IUPAC name is ethyl 4-methoxy-6-[(4-methoxyphenyl)methyl]-5-oxo-7,8-dihydro-2,6-naphthyridine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-methoxy-6-[(4-methoxyphenyl)methyl]-5-oxo-7,8-dihydro-2,6-naphthyridine-1-carboxylate |
| PubChem CID | 67515740 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | ethyl 4-methoxy-6-[(4-methoxyphenyl)methyl]-5-oxo-7,8-dihydro-2,6-naphthyridine-1-carboxylate |
| SMILES | CCOC(=O)c1ncc(OC)c2c1CCN(Cc1ccc(OC)cc1)C2=O |
| InChI | InChI=1S/C20H22N2O5/c1-4-27-20(24)18-15-9-10-22(12-13-5-7-14(25-2)8-6-13)19(23)17(15)16(26-3)11-21-18/h5-8,11H,4,9-10,12H2,1-3H3 |
| InChIKey | VDEQYLBZMCDCQF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 4-methoxy-6-[(4-methoxyphenyl)methyl]-5-oxo-7,8-dihydro-2,6-naphthyridine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-methoxy-6-[(4-methoxyphenyl)methyl]-5-oxo-7,8-dihydro-2,6-naphthyridine-1-carboxylate?
The IUPAC name of ethyl 4-methoxy-6-[(4-methoxyphenyl)methyl]-5-oxo-7,8-dihydro-2,6-naphthyridine-1-carboxylate (CID 67515740) is ethyl 4-methoxy-6-[(4-methoxyphenyl)methyl]-5-oxo-7,8-dihydro-2,6-naphthyridine-1-carboxylate.
What is the SMILES notation for ethyl 4-methoxy-6-[(4-methoxyphenyl)methyl]-5-oxo-7,8-dihydro-2,6-naphthyridine-1-carboxylate?
The canonical SMILES for ethyl 4-methoxy-6-[(4-methoxyphenyl)methyl]-5-oxo-7,8-dihydro-2,6-naphthyridine-1-carboxylate is CCOC(=O)c1ncc(OC)c2c1CCN(Cc1ccc(OC)cc1)C2=O.
What is the InChIKey of ethyl 4-methoxy-6-[(4-methoxyphenyl)methyl]-5-oxo-7,8-dihydro-2,6-naphthyridine-1-carboxylate?
The InChIKey is VDEQYLBZMCDCQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N2O5/c1-4-27-20(24)18-15-9-10-22(12-13-5-7-14(25-2)8-6-13)19(23)17(15)16(26-3)11-21-18/h5-8,11H,4,9-10,12H2,1-3H3.
What are the key properties of ethyl 4-methoxy-6-[(4-methoxyphenyl)methyl]-5-oxo-7,8-dihydro-2,6-naphthyridine-1-carboxylate?
ethyl 4-methoxy-6-[(4-methoxyphenyl)methyl]-5-oxo-7,8-dihydro-2,6-naphthyridine-1-carboxylate has a molecular weight of 370.41 g/mol, XLogP of 2.47, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-methoxy-6-[(4-methoxyphenyl)methyl]-5-oxo-7,8-dihydro-2,6-naphthyridine-1-carboxylate is sourced from PubChem (CID 67515740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).