C20H26N6O4S — CID 166572700
1-[[6-(aminomethyl)-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl]sulfonyl]-3-(4-methyl-2-azatricyclo[7.3.0.03,7]dodeca-1(9),2,7-trien-8-yl)urea (PubChem CID 166572700) has the molecular formula C20H26N6O4S and a molecular weight of 446.53 g/mol. Its IUPAC name is 1-[[6-(aminomethyl)-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl]sulfonyl]-3-(4-methyl-2-azatricyclo[7.3.0.03,7]dodeca-1(9),2,7-trien-8-yl)urea.
| Compound Name | 1-[[6-(aminomethyl)-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl]sulfonyl]-3-(4-methyl-2-azatricyclo[7.3.0.03,7]dodeca-1(9),2,7-trien-8-yl)urea |
|---|---|
| PubChem CID | 166572700 |
| Molecular Formula | C20H26N6O4S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 1-[[6-(aminomethyl)-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl]sulfonyl]-3-(4-methyl-2-azatricyclo[7.3.0.03,7]dodeca-1(9),2,7-trien-8-yl)urea |
| SMILES | CC1CCc2c1nc1c(c2NC(=O)NS(=O)(=O)c2cnn3c2OCC(CN)C3)CCC1 |
| InChI | InChI=1S/C20H26N6O4S/c1-11-5-6-14-17(11)23-15-4-2-3-13(15)18(14)24-20(27)25-31(28,29)16-8-22-26-9-12(7-21)10-30-19(16)26/h8,11-12H,2-7,9-10,21H2,1H3,(H2,23,24,25,27) |
| InChIKey | WUXHMLFLHZPQKP-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 141.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |