C22H28N6O4S — CID 167303899
1-(2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),8-trien-8-yl)-3-[(6-pyrrolidin-1-yl-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl)sulfonyl]urea (PubChem CID 167303899) has the molecular formula C22H28N6O4S and a molecular weight of 472.57 g/mol. Its IUPAC name is 1-(2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),8-trien-8-yl)-3-[(6-pyrrolidin-1-yl-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl)sulfonyl]urea.
| Compound Name | 1-(2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),8-trien-8-yl)-3-[(6-pyrrolidin-1-yl-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl)sulfonyl]urea |
|---|---|
| PubChem CID | 167303899 |
| Molecular Formula | C22H28N6O4S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 1-(2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),8-trien-8-yl)-3-[(6-pyrrolidin-1-yl-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl)sulfonyl]urea |
| SMILES | O=C(Nc1c2c(nc3c1CCC3)CCC2)NS(=O)(=O)c1cnn2c1OCC(N1CCCC1)C2 |
| InChI | InChI=1S/C22H28N6O4S/c29-22(25-20-15-5-3-7-17(15)24-18-8-4-6-16(18)20)26-33(30,31)19-11-23-28-12-14(13-32-21(19)28)27-9-1-2-10-27/h11,14H,1-10,12-13H2,(H2,24,25,26,29) |
| InChIKey | BYTNTDDFHJICSA-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |