C20H23N5O5S — CID 166572695
1-(2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),8-trien-8-yl)-3-spiro[5,7-dihydropyrazolo[5,1-b][1,3]oxazine-6,3'-oxetane]-3-ylsulfonylurea (PubChem CID 166572695) has the molecular formula C20H23N5O5S and a molecular weight of 445.50 g/mol. Its IUPAC name is 1-(2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),8-trien-8-yl)-3-spiro[5,7-dihydropyrazolo[5,1-b][1,3]oxazine-6,3'-oxetane]-3-ylsulfonylurea.
| Compound Name | 1-(2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),8-trien-8-yl)-3-spiro[5,7-dihydropyrazolo[5,1-b][1,3]oxazine-6,3'-oxetane]-3-ylsulfonylurea |
|---|---|
| PubChem CID | 166572695 |
| Molecular Formula | C20H23N5O5S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 1-(2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),8-trien-8-yl)-3-spiro[5,7-dihydropyrazolo[5,1-b][1,3]oxazine-6,3'-oxetane]-3-ylsulfonylurea |
| SMILES | O=C(Nc1c2c(nc3c1CCC3)CCC2)NS(=O)(=O)c1cnn2c1OCC1(COC1)C2 |
| InChI | InChI=1S/C20H23N5O5S/c26-19(23-17-12-3-1-5-14(12)22-15-6-2-4-13(15)17)24-31(27,28)16-7-21-25-8-20(9-29-10-20)11-30-18(16)25/h7H,1-6,8-11H2,(H2,22,23,24,26) |
| InChIKey | BWPQFMCOWXXRTJ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 124.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |