C22H23F2N9O3 — CID 166573187
[(1R)-1-(2,5-difluoro-3-pyridinyl)ethyl] N-[(Z)-2-amino-1-[amino(methyl)amino]-2-[5-[(6-methylpyridazine-4-carbonyl)amino]-2-pyridinyl]ethenyl]carbamate (PubChem CID 166573187) has the molecular formula C22H23F2N9O3 and a molecular weight of 499.48 g/mol. Its IUPAC name is [(1R)-1-(2,5-difluoro-3-pyridinyl)ethyl] N-[(Z)-2-amino-1-[amino(methyl)amino]-2-[5-[(6-methylpyridazine-4-carbonyl)amino]-2-pyridinyl]ethenyl]carbamate.
| Compound Name | [(1R)-1-(2,5-difluoro-3-pyridinyl)ethyl] N-[(Z)-2-amino-1-[amino(methyl)amino]-2-[5-[(6-methylpyridazine-4-carbonyl)amino]-2-pyridinyl]ethenyl]carbamate |
|---|---|
| PubChem CID | 166573187 |
| Molecular Formula | C22H23F2N9O3 |
| Molecular Weight | 499.48 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | [(1R)-1-(2,5-difluoro-3-pyridinyl)ethyl] N-[(Z)-2-amino-1-[amino(methyl)amino]-2-[5-[(6-methylpyridazine-4-carbonyl)amino]-2-pyridinyl]ethenyl]carbamate |
| SMILES | Cc1cc(C(=O)Nc2ccc(/C(N)=C(\NC(=O)O[C@H](C)c3cc(F)cnc3F)N(C)N)nc2)cnn1 |
| InChI | InChI=1S/C22H23F2N9O3/c1-11-6-13(8-29-32-11)21(34)30-15-4-5-17(27-10-15)18(25)20(33(3)26)31-22(35)36-12(2)16-7-14(23)9-28-19(16)24/h4-10,12H,25-26H2,1-3H3,(H,30,34)(H,31,35)/b20-18-/t12-/m1/s1 |
| InChIKey | KIFCHKUUDVMQLD-LDTKGLONSA-N |
| XLogP | 1.98 |
| TPSA | 174.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.48 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|