C22H20F5N9O3 — CID 167358589
[(1R)-1-(2,5-difluoro-3-pyridinyl)ethyl] N-[(Z)-2-amino-1-[amino(methyl)amino]-2-[5-[[6-(trifluoromethyl)pyridazine-4-carbonyl]amino]-2-pyridinyl]ethenyl]carbamate (PubChem CID 167358589) has the molecular formula C22H20F5N9O3 and a molecular weight of 553.45 g/mol. Its IUPAC name is [(1R)-1-(2,5-difluoro-3-pyridinyl)ethyl] N-[(Z)-2-amino-1-[amino(methyl)amino]-2-[5-[[6-(trifluoromethyl)pyridazine-4-carbonyl]amino]-2-pyridinyl]ethenyl]carbamate.
| Compound Name | [(1R)-1-(2,5-difluoro-3-pyridinyl)ethyl] N-[(Z)-2-amino-1-[amino(methyl)amino]-2-[5-[[6-(trifluoromethyl)pyridazine-4-carbonyl]amino]-2-pyridinyl]ethenyl]carbamate |
|---|---|
| PubChem CID | 167358589 |
| Molecular Formula | C22H20F5N9O3 |
| Molecular Weight | 553.45 g/mol |
| Exact Mass | 553.16 |
| IUPAC Name | [(1R)-1-(2,5-difluoro-3-pyridinyl)ethyl] N-[(Z)-2-amino-1-[amino(methyl)amino]-2-[5-[[6-(trifluoromethyl)pyridazine-4-carbonyl]amino]-2-pyridinyl]ethenyl]carbamate |
| SMILES | C[C@@H](OC(=O)N/C(=C(/N)c1ccc(NC(=O)c2cnnc(C(F)(F)F)c2)cn1)N(C)N)c1cc(F)cnc1F |
| InChI | InChI=1S/C22H20F5N9O3/c1-10(14-6-12(23)8-31-18(14)24)39-21(38)34-19(36(2)29)17(28)15-4-3-13(9-30-15)33-20(37)11-5-16(22(25,26)27)35-32-7-11/h3-10H,28-29H2,1-2H3,(H,33,37)(H,34,38)/b19-17-/t10-/m1/s1 |
| InChIKey | LMYLHMTZXQBGEP-FHFYJZPISA-N |
| XLogP | 2.69 |
| TPSA | 174.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|