C42H38IrN2SSi-2 — CID 166575000
iridium;1-(8-phenyl-3H-dibenzothiophen-3-id-4-yl)-5,6,7,8-tetrahydroisoquinoline;trimethyl-(4-methyl-6-phenyl-3-pyridinyl)silane (PubChem CID 166575000) has the molecular formula C42H38IrN2SSi-2 and a molecular weight of 823.15 g/mol. Its IUPAC name is iridium;1-(8-phenyl-3H-dibenzothiophen-3-id-4-yl)-5,6,7,8-tetrahydroisoquinoline;trimethyl-(4-methyl-6-phenyl-3-pyridinyl)silane.
| Compound Name | iridium;1-(8-phenyl-3H-dibenzothiophen-3-id-4-yl)-5,6,7,8-tetrahydroisoquinoline;trimethyl-(4-methyl-6-phenyl-3-pyridinyl)silane |
|---|---|
| PubChem CID | 166575000 |
| Molecular Formula | C42H38IrN2SSi-2 |
| Molecular Weight | 823.15 g/mol |
| Exact Mass | 823.22 |
| IUPAC Name | iridium;1-(8-phenyl-3H-dibenzothiophen-3-id-4-yl)-5,6,7,8-tetrahydroisoquinoline;trimethyl-(4-methyl-6-phenyl-3-pyridinyl)silane |
| SMILES | Cc1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.[Ir].[c-]1ccc2c(sc3ccc(-c4ccccc4)cc32)c1-c1nccc2c1CCCC2 |
| InChI | InChI=1S/C27H20NS.C15H18NSi.Ir/c1-2-7-18(8-3-1)20-13-14-25-24(17-20)22-11-6-12-23(27(22)29-25)26-21-10-5-4-9-19(21)15-16-28-26;1-12-10-14(13-8-6-5-7-9-13)16-11-15(12)17(2,3)4;/h1-3,6-8,11,13-17H,4-5,9-10H2;5-8,10-11H,1-4H3;/q2*-1; |
| InChIKey | FTSCUFHHQLNNLE-UHFFFAOYSA-N |
| XLogP | 10.86 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.15 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|