C13H20BrNO2 — CID 16658084
(3R,4aR,8R)-3-(bromomethyl)-8-tert-butyl-4,4a,5,8-tetrahydro-3H-pyrido[1,2-c][1,3]oxazin-1-one (PubChem CID 16658084) has the molecular formula C13H20BrNO2 and a molecular weight of 302.21 g/mol. Its IUPAC name is (3R,4aR,8R)-3-(bromomethyl)-8-tert-butyl-4,4a,5,8-tetrahydro-3H-pyrido[1,2-c][1,3]oxazin-1-one.
| Compound Name | (3R,4aR,8R)-3-(bromomethyl)-8-tert-butyl-4,4a,5,8-tetrahydro-3H-pyrido[1,2-c][1,3]oxazin-1-one |
|---|---|
| PubChem CID | 16658084 |
| Molecular Formula | C13H20BrNO2 |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | (3R,4aR,8R)-3-(bromomethyl)-8-tert-butyl-4,4a,5,8-tetrahydro-3H-pyrido[1,2-c][1,3]oxazin-1-one |
| SMILES | CC(C)(C)[C@H]1C=CC[C@@H]2C[C@H](CBr)OC(=O)N21 |
| InChI | InChI=1S/C13H20BrNO2/c1-13(2,3)11-6-4-5-9-7-10(8-14)17-12(16)15(9)11/h4,6,9-11H,5,7-8H2,1-3H3/t9-,10-,11-/m1/s1 |
| InChIKey | RYNXUBBDRVNQGU-GMTAPVOTSA-N |
| XLogP | 3.34 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|