C10H14BrNO2 — CID 102077157
(3S,4aR,8S)-3-(bromomethyl)-8-methyl-4,4a,5,8-tetrahydro-3H-pyrido[1,2-c][1,3]oxazin-1-one (PubChem CID 102077157) has the molecular formula C10H14BrNO2 and a molecular weight of 260.13 g/mol. Its IUPAC name is (3S,4aR,8S)-3-(bromomethyl)-8-methyl-4,4a,5,8-tetrahydro-3H-pyrido[1,2-c][1,3]oxazin-1-one.
| Compound Name | (3S,4aR,8S)-3-(bromomethyl)-8-methyl-4,4a,5,8-tetrahydro-3H-pyrido[1,2-c][1,3]oxazin-1-one |
|---|---|
| PubChem CID | 102077157 |
| Molecular Formula | C10H14BrNO2 |
| Molecular Weight | 260.13 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | (3S,4aR,8S)-3-(bromomethyl)-8-methyl-4,4a,5,8-tetrahydro-3H-pyrido[1,2-c][1,3]oxazin-1-one |
| SMILES | C[C@H]1C=CC[C@@H]2C[C@@H](CBr)OC(=O)N21 |
| InChI | InChI=1S/C10H14BrNO2/c1-7-3-2-4-8-5-9(6-11)14-10(13)12(7)8/h2-3,7-9H,4-6H2,1H3/t7-,8+,9-/m0/s1 |
| InChIKey | CXTQVNHMEALHNJ-YIZRAAEISA-N |
| XLogP | 2.31 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.13 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|