C12H14BrNO2 — CID 16658089
(4aS,8S)-5-bromo-3-methylidene-8-prop-2-enyl-4,4a,7,8-tetrahydropyrido[1,2-c][1,3]oxazin-1-one (PubChem CID 16658089) has the molecular formula C12H14BrNO2 and a molecular weight of 284.15 g/mol. Its IUPAC name is (4aS,8S)-5-bromo-3-methylidene-8-prop-2-enyl-4,4a,7,8-tetrahydropyrido[1,2-c][1,3]oxazin-1-one.
| Compound Name | (4aS,8S)-5-bromo-3-methylidene-8-prop-2-enyl-4,4a,7,8-tetrahydropyrido[1,2-c][1,3]oxazin-1-one |
|---|---|
| PubChem CID | 16658089 |
| Molecular Formula | C12H14BrNO2 |
| Molecular Weight | 284.15 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | (4aS,8S)-5-bromo-3-methylidene-8-prop-2-enyl-4,4a,7,8-tetrahydropyrido[1,2-c][1,3]oxazin-1-one |
| SMILES | C=CC[C@H]1CC=C(Br)[C@@H]2CC(=C)OC(=O)N12 |
| InChI | InChI=1S/C12H14BrNO2/c1-3-4-9-5-6-10(13)11-7-8(2)16-12(15)14(9)11/h3,6,9,11H,1-2,4-5,7H2/t9-,11-/m0/s1 |
| InChIKey | APYRDENPLXSCGD-ONGXEEELSA-N |
| XLogP | 3.34 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.15 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|