C10H13NO2 — CID 16658085
(4aR,8S)-8-methyl-3-methylidene-4,4a,5,8-tetrahydropyrido[1,2-c][1,3]oxazin-1-one (PubChem CID 16658085) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is (4aR,8S)-8-methyl-3-methylidene-4,4a,5,8-tetrahydropyrido[1,2-c][1,3]oxazin-1-one.
| Compound Name | (4aR,8S)-8-methyl-3-methylidene-4,4a,5,8-tetrahydropyrido[1,2-c][1,3]oxazin-1-one |
|---|---|
| PubChem CID | 16658085 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | (4aR,8S)-8-methyl-3-methylidene-4,4a,5,8-tetrahydropyrido[1,2-c][1,3]oxazin-1-one |
| SMILES | C=C1C[C@H]2CC=C[C@H](C)N2C(=O)O1 |
| InChI | InChI=1S/C10H13NO2/c1-7-4-3-5-9-6-8(2)13-10(12)11(7)9/h3-4,7,9H,2,5-6H2,1H3/t7-,9+/m0/s1 |
| InChIKey | BEYGGRBHZPKGKY-IONNQARKSA-N |
| XLogP | 2.06 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|