C13H19NO2 — CID 16658086
(4aR,8R)-8-tert-butyl-3-methylidene-4,4a,5,8-tetrahydropyrido[1,2-c][1,3]oxazin-1-one (PubChem CID 16658086) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is (4aR,8R)-8-tert-butyl-3-methylidene-4,4a,5,8-tetrahydropyrido[1,2-c][1,3]oxazin-1-one.
| Compound Name | (4aR,8R)-8-tert-butyl-3-methylidene-4,4a,5,8-tetrahydropyrido[1,2-c][1,3]oxazin-1-one |
|---|---|
| PubChem CID | 16658086 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | (4aR,8R)-8-tert-butyl-3-methylidene-4,4a,5,8-tetrahydropyrido[1,2-c][1,3]oxazin-1-one |
| SMILES | C=C1C[C@H]2CC=C[C@H](C(C)(C)C)N2C(=O)O1 |
| InChI | InChI=1S/C13H19NO2/c1-9-8-10-6-5-7-11(13(2,3)4)14(10)12(15)16-9/h5,7,10-11H,1,6,8H2,2-4H3/t10-,11-/m1/s1 |
| InChIKey | SXLFBMFYSDQXFM-GHMZBOCLSA-N |
| XLogP | 3.09 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|