C26H24Br2ClN — CID 166583647
6-(3,5-dibromo-4-chlorophenyl)-4a,9a-dimethyl-9-phenyl-1,2,3,4-tetrahydrocarbazole (PubChem CID 166583647) has the molecular formula C26H24Br2ClN and a molecular weight of 545.75 g/mol. Its IUPAC name is 6-(3,5-dibromo-4-chlorophenyl)-4a,9a-dimethyl-9-phenyl-1,2,3,4-tetrahydrocarbazole.
| Compound Name | 6-(3,5-dibromo-4-chlorophenyl)-4a,9a-dimethyl-9-phenyl-1,2,3,4-tetrahydrocarbazole |
|---|---|
| PubChem CID | 166583647 |
| Molecular Formula | C26H24Br2ClN |
| Molecular Weight | 545.75 g/mol |
| Exact Mass | 543.00 |
| IUPAC Name | 6-(3,5-dibromo-4-chlorophenyl)-4a,9a-dimethyl-9-phenyl-1,2,3,4-tetrahydrocarbazole |
| SMILES | CC12CCCCC1(C)N(c1ccccc1)c1ccc(-c3cc(Br)c(Cl)c(Br)c3)cc12 |
| InChI | InChI=1S/C26H24Br2ClN/c1-25-12-6-7-13-26(25,2)30(19-8-4-3-5-9-19)23-11-10-17(14-20(23)25)18-15-21(27)24(29)22(28)16-18/h3-5,8-11,14-16H,6-7,12-13H2,1-2H3 |
| InChIKey | JYBCFBCBSXQFKH-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.75 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|