C45H33N2OP — CID 166584766
17-[4-(4-dimethylphosphorylphenyl)phenyl]-3,14-diphenyl-3,15-diazapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(21),2(10),4,6,8,11,13,15,17,19-decaene (PubChem CID 166584766) has the molecular formula C45H33N2OP and a molecular weight of 648.75 g/mol. Its IUPAC name is 17-[4-(4-dimethylphosphorylphenyl)phenyl]-3,14-diphenyl-3,15-diazapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(21),2(10),4,6,8,11,13,15,17,19-decaene.
| Compound Name | 17-[4-(4-dimethylphosphorylphenyl)phenyl]-3,14-diphenyl-3,15-diazapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(21),2(10),4,6,8,11,13,15,17,19-decaene |
|---|---|
| PubChem CID | 166584766 |
| Molecular Formula | C45H33N2OP |
| Molecular Weight | 648.75 g/mol |
| Exact Mass | 648.23 |
| IUPAC Name | 17-[4-(4-dimethylphosphorylphenyl)phenyl]-3,14-diphenyl-3,15-diazapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(21),2(10),4,6,8,11,13,15,17,19-decaene |
| SMILES | CP(C)(=O)c1ccc(-c2ccc(-c3cccc4c3nc(-c3ccccc3)c3ccc5c6ccccc6n(-c6ccccc6)c5c34)cc2)cc1 |
| InChI | InChI=1S/C45H33N2OP/c1-49(2,48)35-26-24-31(25-27-35)30-20-22-32(23-21-30)36-17-11-18-39-42-40(43(46-44(36)39)33-12-5-3-6-13-33)29-28-38-37-16-9-10-19-41(37)47(45(38)42)34-14-7-4-8-15-34/h3-29H,1-2H3 |
| InChIKey | UELJMLORJXLLAG-UHFFFAOYSA-N |
| XLogP | 11.73 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.75 |
| LogP ≤ 5 | 11.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|