C24H32BN4O3 — CID 166586325
CID 166586325 (PubChem CID 166586325) has the molecular formula C24H32BN4O3 and a molecular weight of 435.36 g/mol.
| Compound Name | CID 166586325 |
|---|---|
| PubChem CID | 166586325 |
| Molecular Formula | C24H32BN4O3 |
| Molecular Weight | 435.36 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | — |
| SMILES | COCOc1cc(C)ccc1-c1ccc(N(C)C2C[C@]3(C)CC[C@](C)(C2)N3[B]C=O)nn1 |
| InChI | InChI=1S/C24H32BN4O3/c1-17-6-7-19(21(12-17)32-16-31-5)20-8-9-22(27-26-20)28(4)18-13-23(2)10-11-24(3,14-18)29(23)25-15-30/h6-9,12,15,18H,10-11,13-14,16H2,1-5H3/t18?,23-,24+ |
| InChIKey | HDRASJUEKSVYLN-OIPYLKGRSA-N |
| XLogP | 3.46 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|