C13H18N4O3 — CID 16659031
4-[[(E)-1-(3-aminophenyl)ethylideneamino]carbamoylamino]butanoic acid (PubChem CID 16659031) has the molecular formula C13H18N4O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is 4-[[(E)-1-(3-aminophenyl)ethylideneamino]carbamoylamino]butanoic acid.
| Compound Name | 4-[[(E)-1-(3-aminophenyl)ethylideneamino]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 16659031 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 4-[[(E)-1-(3-aminophenyl)ethylideneamino]carbamoylamino]butanoic acid |
| SMILES | C/C(=N\NC(=O)NCCCC(=O)O)c1cccc(N)c1 |
| InChI | InChI=1S/C13H18N4O3/c1-9(10-4-2-5-11(14)8-10)16-17-13(20)15-7-3-6-12(18)19/h2,4-5,8H,3,6-7,14H2,1H3,(H,18,19)(H2,15,17,20)/b16-9+ |
| InChIKey | QFNXJUSLJLRDPM-CXUHLZMHSA-N |
| XLogP | 1.16 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|