C38H38N4O2 — CID 166590436
8-[(1-benzylindol-3-yl)methyl]-3,3-dimethyl-2-[(4-phenylphenyl)methyl]-6,7,9,9a-tetrahydropyrazino[1,2-a]pyrazine-1,4-dione (PubChem CID 166590436) has the molecular formula C38H38N4O2 and a molecular weight of 582.75 g/mol. Its IUPAC name is 8-[(1-benzylindol-3-yl)methyl]-3,3-dimethyl-2-[(4-phenylphenyl)methyl]-6,7,9,9a-tetrahydropyrazino[1,2-a]pyrazine-1,4-dione.
| Compound Name | 8-[(1-benzylindol-3-yl)methyl]-3,3-dimethyl-2-[(4-phenylphenyl)methyl]-6,7,9,9a-tetrahydropyrazino[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 166590436 |
| Molecular Formula | C38H38N4O2 |
| Molecular Weight | 582.75 g/mol |
| Exact Mass | 582.30 |
| IUPAC Name | 8-[(1-benzylindol-3-yl)methyl]-3,3-dimethyl-2-[(4-phenylphenyl)methyl]-6,7,9,9a-tetrahydropyrazino[1,2-a]pyrazine-1,4-dione |
| SMILES | CC1(C)C(=O)N2CCN(Cc3cn(Cc4ccccc4)c4ccccc34)CC2C(=O)N1Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C38H38N4O2/c1-38(2)37(44)41-22-21-39(25-32-26-40(23-28-11-5-3-6-12-28)34-16-10-9-15-33(32)34)27-35(41)36(43)42(38)24-29-17-19-31(20-18-29)30-13-7-4-8-14-30/h3-20,26,35H,21-25,27H2,1-2H3 |
| InChIKey | LCNMVGCTDHLMKF-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 48.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.75 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |