C32H30N2O2 — CID 171398403
8-(naphthalen-1-ylmethyl)-2-[(4-phenylphenyl)methyl]-1,3,4,7,8,9a-hexahydropyrido[1,2-a]pyrazine-6,9-dione (PubChem CID 171398403) has the molecular formula C32H30N2O2 and a molecular weight of 474.60 g/mol. Its IUPAC name is 8-(naphthalen-1-ylmethyl)-2-[(4-phenylphenyl)methyl]-1,3,4,7,8,9a-hexahydropyrido[1,2-a]pyrazine-6,9-dione.
| Compound Name | 8-(naphthalen-1-ylmethyl)-2-[(4-phenylphenyl)methyl]-1,3,4,7,8,9a-hexahydropyrido[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 171398403 |
| Molecular Formula | C32H30N2O2 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | 8-(naphthalen-1-ylmethyl)-2-[(4-phenylphenyl)methyl]-1,3,4,7,8,9a-hexahydropyrido[1,2-a]pyrazine-6,9-dione |
| SMILES | O=C1C(Cc2cccc3ccccc23)CC(=O)N2CCN(Cc3ccc(-c4ccccc4)cc3)CC12 |
| InChI | InChI=1S/C32H30N2O2/c35-31-20-28(19-27-11-6-10-26-9-4-5-12-29(26)27)32(36)30-22-33(17-18-34(30)31)21-23-13-15-25(16-14-23)24-7-2-1-3-8-24/h1-16,28,30H,17-22H2 |
| InChIKey | FOPRKAJUOINFJS-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |