C26H26N2O2 — CID 23121897
7-[(4-methylphenyl)methyl]-1,1-diphenyl-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazin-3-one (PubChem CID 23121897) has the molecular formula C26H26N2O2 and a molecular weight of 398.51 g/mol. Its IUPAC name is 7-[(4-methylphenyl)methyl]-1,1-diphenyl-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazin-3-one.
| Compound Name | 7-[(4-methylphenyl)methyl]-1,1-diphenyl-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazin-3-one |
|---|---|
| PubChem CID | 23121897 |
| Molecular Formula | C26H26N2O2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 7-[(4-methylphenyl)methyl]-1,1-diphenyl-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazin-3-one |
| SMILES | Cc1ccc(CN2CCN3C(=O)OC(c4ccccc4)(c4ccccc4)C3C2)cc1 |
| InChI | InChI=1S/C26H26N2O2/c1-20-12-14-21(15-13-20)18-27-16-17-28-24(19-27)26(30-25(28)29,22-8-4-2-5-9-22)23-10-6-3-7-11-23/h2-15,24H,16-19H2,1H3 |
| InChIKey | WGTGFLNMBDNNDT-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |