C28H30N2O2 — CID 23121840
1,1-bis(4-methylphenyl)-7-[(4-methylphenyl)methyl]-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazin-3-one (PubChem CID 23121840) has the molecular formula C28H30N2O2 and a molecular weight of 426.56 g/mol. Its IUPAC name is 1,1-bis(4-methylphenyl)-7-[(4-methylphenyl)methyl]-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazin-3-one.
| Compound Name | 1,1-bis(4-methylphenyl)-7-[(4-methylphenyl)methyl]-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazin-3-one |
|---|---|
| PubChem CID | 23121840 |
| Molecular Formula | C28H30N2O2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 1,1-bis(4-methylphenyl)-7-[(4-methylphenyl)methyl]-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazin-3-one |
| SMILES | Cc1ccc(CN2CCN3C(=O)OC(c4ccc(C)cc4)(c4ccc(C)cc4)C3C2)cc1 |
| InChI | InChI=1S/C28H30N2O2/c1-20-4-10-23(11-5-20)18-29-16-17-30-26(19-29)28(32-27(30)31,24-12-6-21(2)7-13-24)25-14-8-22(3)9-15-25/h4-15,26H,16-19H2,1-3H3 |
| InChIKey | FUXZGOOQUNDNCO-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |