C32H37N3O2 — CID 171398229
3-benzyl-2-(cyclohexylmethyl)-8-(naphthalen-1-ylmethyl)-6,7,9,9a-tetrahydro-3H-pyrazino[1,2-a]pyrazine-1,4-dione (PubChem CID 171398229) has the molecular formula C32H37N3O2 and a molecular weight of 495.67 g/mol. Its IUPAC name is 3-benzyl-2-(cyclohexylmethyl)-8-(naphthalen-1-ylmethyl)-6,7,9,9a-tetrahydro-3H-pyrazino[1,2-a]pyrazine-1,4-dione.
| Compound Name | 3-benzyl-2-(cyclohexylmethyl)-8-(naphthalen-1-ylmethyl)-6,7,9,9a-tetrahydro-3H-pyrazino[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 171398229 |
| Molecular Formula | C32H37N3O2 |
| Molecular Weight | 495.67 g/mol |
| Exact Mass | 495.29 |
| IUPAC Name | 3-benzyl-2-(cyclohexylmethyl)-8-(naphthalen-1-ylmethyl)-6,7,9,9a-tetrahydro-3H-pyrazino[1,2-a]pyrazine-1,4-dione |
| SMILES | O=C1C(Cc2ccccc2)N(CC2CCCCC2)C(=O)C2CN(Cc3cccc4ccccc34)CCN12 |
| InChI | InChI=1S/C32H37N3O2/c36-31-29(20-24-10-3-1-4-11-24)35(21-25-12-5-2-6-13-25)32(37)30-23-33(18-19-34(30)31)22-27-16-9-15-26-14-7-8-17-28(26)27/h1,3-4,7-11,14-17,25,29-30H,2,5-6,12-13,18-23H2 |
| InChIKey | IMJQFLRZJUNMEM-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.67 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |