C11H9Cl2N5O2 — CID 166593697
N'-(4,6-dichloro-1,3,5-triazin-2-yl)-4-methoxybenzohydrazide (PubChem CID 166593697) has the molecular formula C11H9Cl2N5O2 and a molecular weight of 314.13 g/mol. Its IUPAC name is N'-(4,6-dichloro-1,3,5-triazin-2-yl)-4-methoxybenzohydrazide.
| Compound Name | N'-(4,6-dichloro-1,3,5-triazin-2-yl)-4-methoxybenzohydrazide |
|---|---|
| PubChem CID | 166593697 |
| Molecular Formula | C11H9Cl2N5O2 |
| Molecular Weight | 314.13 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | N'-(4,6-dichloro-1,3,5-triazin-2-yl)-4-methoxybenzohydrazide |
| SMILES | COc1ccc(C(=O)NNc2nc(Cl)nc(Cl)n2)cc1 |
| InChI | InChI=1S/C11H9Cl2N5O2/c1-20-7-4-2-6(3-5-7)8(19)17-18-11-15-9(12)14-10(13)16-11/h2-5H,1H3,(H,17,19)(H,14,15,16,18) |
| InChIKey | CHINFECWSFUFGM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.13 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|