About (3R)-3-benzyl-1-(2-methoxyethyl)-4-(2-phenylmethoxyethyl)piperazine-2,5-dione;formic acid
(3R)-3-benzyl-1-(2-methoxyethyl)-4-(2-phenylmethoxyethyl)piperazine-2,5-dione;formic acid (PubChem CID 166598382) has the molecular formula C24H30N2O6
and a molecular weight of 442.51 g/mol. Its IUPAC name is (3R)-3-benzyl-1-(2-methoxyethyl)-4-(2-phenylmethoxyethyl)piperazine-2,5-dione;formic acid.
Molecular Properties
| Compound Name | (3R)-3-benzyl-1-(2-methoxyethyl)-4-(2-phenylmethoxyethyl)piperazine-2,5-dione;formic acid |
| PubChem CID | 166598382 |
| Molecular Formula | C24H30N2O6 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | (3R)-3-benzyl-1-(2-methoxyethyl)-4-(2-phenylmethoxyethyl)piperazine-2,5-dione;formic acid |
| SMILES | COCCN1CC(=O)N(CCOCc2ccccc2)[C@H](Cc2ccccc2)C1=O.O=CO |
| InChI | InChI=1S/C23H28N2O4.CH2O2/c1-28-14-12-24-17-22(26)25(13-15-29-18-20-10-6-3-7-11-20)21(23(24)27)16-19-8-4-2-5-9-19;2-1-3/h2-11,21H,12-18H2,1H3;1H,(H,2,3)/t21-;/m1./s1 |
| InChIKey | WRSMEZXFOPPRAY-ZMBIFBSDSA-N |
| XLogP | 1.83 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-benzyl-1-(2-methoxyethyl)-4-(2-phenylmethoxyethyl)piperazine-2,5-dione;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-benzyl-1-(2-methoxyethyl)-4-(2-phenylmethoxyethyl)piperazine-2,5-dione;formic acid?
The IUPAC name of (3R)-3-benzyl-1-(2-methoxyethyl)-4-(2-phenylmethoxyethyl)piperazine-2,5-dione;formic acid (CID 166598382) is (3R)-3-benzyl-1-(2-methoxyethyl)-4-(2-phenylmethoxyethyl)piperazine-2,5-dione;formic acid.
What is the SMILES notation for (3R)-3-benzyl-1-(2-methoxyethyl)-4-(2-phenylmethoxyethyl)piperazine-2,5-dione;formic acid?
The canonical SMILES for (3R)-3-benzyl-1-(2-methoxyethyl)-4-(2-phenylmethoxyethyl)piperazine-2,5-dione;formic acid is COCCN1CC(=O)N(CCOCc2ccccc2)[C@H](Cc2ccccc2)C1=O.O=CO.
What is the InChIKey of (3R)-3-benzyl-1-(2-methoxyethyl)-4-(2-phenylmethoxyethyl)piperazine-2,5-dione;formic acid?
The InChIKey is WRSMEZXFOPPRAY-ZMBIFBSDSA-N. The full InChI is InChI=1S/C23H28N2O4.CH2O2/c1-28-14-12-24-17-22(26)25(13-15-29-18-20-10-6-3-7-11-20)21(23(24)27)16-19-8-4-2-5-9-19;2-1-3/h2-11,21H,12-18H2,1H3;1H,(H,2,3)/t21-;/m1./s1.
What are the key properties of (3R)-3-benzyl-1-(2-methoxyethyl)-4-(2-phenylmethoxyethyl)piperazine-2,5-dione;formic acid?
(3R)-3-benzyl-1-(2-methoxyethyl)-4-(2-phenylmethoxyethyl)piperazine-2,5-dione;formic acid has a molecular weight of 442.51 g/mol, XLogP of 1.83, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-benzyl-1-(2-methoxyethyl)-4-(2-phenylmethoxyethyl)piperazine-2,5-dione;formic acid is sourced from PubChem (CID 166598382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).