C24H30N2O6 — CID 166598382
(3R)-3-benzyl-1-(2-methoxyethyl)-4-(2-phenylmethoxyethyl)piperazine-2,5-dione;formic acid (PubChem CID 166598382) has the molecular formula C24H30N2O6 and a molecular weight of 442.51 g/mol. Its IUPAC name is (3R)-3-benzyl-1-(2-methoxyethyl)-4-(2-phenylmethoxyethyl)piperazine-2,5-dione;formic acid.
| Compound Name | (3R)-3-benzyl-1-(2-methoxyethyl)-4-(2-phenylmethoxyethyl)piperazine-2,5-dione;formic acid |
|---|---|
| PubChem CID | 166598382 |
| Molecular Formula | C24H30N2O6 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | (3R)-3-benzyl-1-(2-methoxyethyl)-4-(2-phenylmethoxyethyl)piperazine-2,5-dione;formic acid |
| SMILES | COCCN1CC(=O)N(CCOCc2ccccc2)[C@H](Cc2ccccc2)C1=O.O=CO |
| InChI | InChI=1S/C23H28N2O4.CH2O2/c1-28-14-12-24-17-22(26)25(13-15-29-18-20-10-6-3-7-11-20)21(23(24)27)16-19-8-4-2-5-9-19;2-1-3/h2-11,21H,12-18H2,1H3;1H,(H,2,3)/t21-;/m1./s1 |
| InChIKey | WRSMEZXFOPPRAY-ZMBIFBSDSA-N |
| XLogP | 1.83 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|