C13H17ClN6O5 — CID 166598459
3-(3-chloro-1,2-oxazol-5-yl)-1-[2-(1-methyltetrazol-5-yl)morpholin-4-yl]propan-1-one;formic acid (PubChem CID 166598459) has the molecular formula C13H17ClN6O5 and a molecular weight of 372.77 g/mol. Its IUPAC name is 3-(3-chloro-1,2-oxazol-5-yl)-1-[2-(1-methyltetrazol-5-yl)morpholin-4-yl]propan-1-one;formic acid.
| Compound Name | 3-(3-chloro-1,2-oxazol-5-yl)-1-[2-(1-methyltetrazol-5-yl)morpholin-4-yl]propan-1-one;formic acid |
|---|---|
| PubChem CID | 166598459 |
| Molecular Formula | C13H17ClN6O5 |
| Molecular Weight | 372.77 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 3-(3-chloro-1,2-oxazol-5-yl)-1-[2-(1-methyltetrazol-5-yl)morpholin-4-yl]propan-1-one;formic acid |
| SMILES | Cn1nnnc1C1CN(C(=O)CCc2cc(Cl)no2)CCO1.O=CO |
| InChI | InChI=1S/C12H15ClN6O3.CH2O2/c1-18-12(14-16-17-18)9-7-19(4-5-21-9)11(20)3-2-8-6-10(13)15-22-8;2-1-3/h6,9H,2-5,7H2,1H3;1H,(H,2,3) |
| InChIKey | DUXDYSFXFISNSF-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 136.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.77 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|