C24H37N3O4 — CID 166599920
1-ethyl-6-methyl-3-[(1R,2S,8S,9S)-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carbonyl]pyridin-2-one;formic acid (PubChem CID 166599920) has the molecular formula C24H37N3O4 and a molecular weight of 431.58 g/mol. Its IUPAC name is 1-ethyl-6-methyl-3-[(1R,2S,8S,9S)-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carbonyl]pyridin-2-one;formic acid.
| Compound Name | 1-ethyl-6-methyl-3-[(1R,2S,8S,9S)-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carbonyl]pyridin-2-one;formic acid |
|---|---|
| PubChem CID | 166599920 |
| Molecular Formula | C24H37N3O4 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.28 |
| IUPAC Name | 1-ethyl-6-methyl-3-[(1R,2S,8S,9S)-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carbonyl]pyridin-2-one;formic acid |
| SMILES | CCC[C@H]1[C@H]2C[C@H](CN(C(=O)c3ccc(C)n(CC)c3=O)C2)[C@@H]2CCCCN21.O=CO |
| InChI | InChI=1S/C23H35N3O2.CH2O2/c1-4-8-20-17-13-18(21-9-6-7-12-26(20)21)15-24(14-17)22(27)19-11-10-16(3)25(5-2)23(19)28;2-1-3/h10-11,17-18,20-21H,4-9,12-15H2,1-3H3;1H,(H,2,3)/t17-,18+,20-,21-;/m0./s1 |
| InChIKey | WYNWLCGFQGWEIK-ZCDMFCAKSA-N |
| XLogP | 2.99 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|