C24H19N5OS — CID 166600575
3-benzyl-2-[(1-phenyltriazol-4-yl)methylsulfanyl]quinazolin-4-one (PubChem CID 166600575) has the molecular formula C24H19N5OS and a molecular weight of 425.52 g/mol. Its IUPAC name is 3-benzyl-2-[(1-phenyltriazol-4-yl)methylsulfanyl]quinazolin-4-one.
| Compound Name | 3-benzyl-2-[(1-phenyltriazol-4-yl)methylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 166600575 |
| Molecular Formula | C24H19N5OS |
| Molecular Weight | 425.52 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 3-benzyl-2-[(1-phenyltriazol-4-yl)methylsulfanyl]quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(SCc2cn(-c3ccccc3)nn2)n1Cc1ccccc1 |
| InChI | InChI=1S/C24H19N5OS/c30-23-21-13-7-8-14-22(21)25-24(28(23)15-18-9-3-1-4-10-18)31-17-19-16-29(27-26-19)20-11-5-2-6-12-20/h1-14,16H,15,17H2 |
| InChIKey | PIBDOXLFQXBVRL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.52 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |