C17H23FN6O2 — CID 166601069
N-[[4-fluoro-1-(9-methylpurin-6-yl)piperidin-4-yl]methyl]oxolane-3-carboxamide (PubChem CID 166601069) has the molecular formula C17H23FN6O2 and a molecular weight of 362.41 g/mol. Its IUPAC name is N-[[4-fluoro-1-(9-methylpurin-6-yl)piperidin-4-yl]methyl]oxolane-3-carboxamide.
| Compound Name | N-[[4-fluoro-1-(9-methylpurin-6-yl)piperidin-4-yl]methyl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 166601069 |
| Molecular Formula | C17H23FN6O2 |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | N-[[4-fluoro-1-(9-methylpurin-6-yl)piperidin-4-yl]methyl]oxolane-3-carboxamide |
| SMILES | Cn1cnc2c(N3CCC(F)(CNC(=O)C4CCOC4)CC3)ncnc21 |
| InChI | InChI=1S/C17H23FN6O2/c1-23-11-22-13-14(23)20-10-21-15(13)24-5-3-17(18,4-6-24)9-19-16(25)12-2-7-26-8-12/h10-12H,2-9H2,1H3,(H,19,25) |
| InChIKey | DSOBLPYVCRAGGB-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |