C15H20BrFN4O2 — CID 165432283
N-[[1-(5-bromopyrimidin-2-yl)-4-fluoropiperidin-4-yl]methyl]oxolane-3-carboxamide (PubChem CID 165432283) has the molecular formula C15H20BrFN4O2 and a molecular weight of 387.25 g/mol. Its IUPAC name is N-[[1-(5-bromopyrimidin-2-yl)-4-fluoropiperidin-4-yl]methyl]oxolane-3-carboxamide.
| Compound Name | N-[[1-(5-bromopyrimidin-2-yl)-4-fluoropiperidin-4-yl]methyl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 165432283 |
| Molecular Formula | C15H20BrFN4O2 |
| Molecular Weight | 387.25 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | N-[[1-(5-bromopyrimidin-2-yl)-4-fluoropiperidin-4-yl]methyl]oxolane-3-carboxamide |
| SMILES | O=C(NCC1(F)CCN(c2ncc(Br)cn2)CC1)C1CCOC1 |
| InChI | InChI=1S/C15H20BrFN4O2/c16-12-7-18-14(19-8-12)21-4-2-15(17,3-5-21)10-20-13(22)11-1-6-23-9-11/h7-8,11H,1-6,9-10H2,(H,20,22) |
| InChIKey | KUIXKDLWKVBAQZ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.25 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |