C14H19Cl2N3O — CID 166602989
1-(3,5-dichloro-2-pyridinyl)-4-(oxolan-3-yl)-1,4-diazepane (PubChem CID 166602989) has the molecular formula C14H19Cl2N3O and a molecular weight of 316.23 g/mol. Its IUPAC name is 1-(3,5-dichloro-2-pyridinyl)-4-(oxolan-3-yl)-1,4-diazepane.
| Compound Name | 1-(3,5-dichloro-2-pyridinyl)-4-(oxolan-3-yl)-1,4-diazepane |
|---|---|
| PubChem CID | 166602989 |
| Molecular Formula | C14H19Cl2N3O |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 1-(3,5-dichloro-2-pyridinyl)-4-(oxolan-3-yl)-1,4-diazepane |
| SMILES | Clc1cnc(N2CCCN(C3CCOC3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C14H19Cl2N3O/c15-11-8-13(16)14(17-9-11)19-4-1-3-18(5-6-19)12-2-7-20-10-12/h8-9,12H,1-7,10H2 |
| InChIKey | JTRVDTIWYBKWED-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |